C12H16F3N3O2S — CID 79466266
2-amino-4-[4-(trifluoromethyl)piperidin-1-yl]benzenesulfonamide (PubChem CID 79466266) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-amino-4-[4-(trifluoromethyl)piperidin-1-yl]benzenesulfonamide.
| Compound Name | 2-amino-4-[4-(trifluoromethyl)piperidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79466266 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-amino-4-[4-(trifluoromethyl)piperidin-1-yl]benzenesulfonamide |
| SMILES | Nc1cc(N2CCC(C(F)(F)F)CC2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H16F3N3O2S/c13-12(14,15)8-3-5-18(6-4-8)9-1-2-11(10(16)7-9)21(17,19)20/h1-2,7-8H,3-6,16H2,(H2,17,19,20) |
| InChIKey | KXCPORCORAZYCU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|