C10H16N4O2S — CID 79466445
2-amino-4-piperazin-1-ylbenzenesulfonamide (PubChem CID 79466445) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-amino-4-piperazin-1-ylbenzenesulfonamide.
| Compound Name | 2-amino-4-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 79466445 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-amino-4-piperazin-1-ylbenzenesulfonamide |
| SMILES | Nc1cc(N2CCNCC2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H16N4O2S/c11-9-7-8(14-5-3-13-4-6-14)1-2-10(9)17(12,15)16/h1-2,7,13H,3-6,11H2,(H2,12,15,16) |
| InChIKey | DSPZUWKNRRBYBW-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|