C10H15N3O3S — CID 113375381
2-amino-4-(oxazinan-2-yl)benzenesulfonamide (PubChem CID 113375381) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-amino-4-(oxazinan-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-(oxazinan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113375381 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-amino-4-(oxazinan-2-yl)benzenesulfonamide |
| SMILES | Nc1cc(N2CCCCO2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H15N3O3S/c11-9-7-8(13-5-1-2-6-16-13)3-4-10(9)17(12,14)15/h3-4,7H,1-2,5-6,11H2,(H2,12,14,15) |
| InChIKey | YHHLSAGYAJRITG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|