C14H23N3O2S — CID 114592056
2-amino-4-(2,3,5-trimethylpiperidin-1-yl)benzenesulfonamide (PubChem CID 114592056) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-amino-4-(2,3,5-trimethylpiperidin-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-(2,3,5-trimethylpiperidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114592056 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-amino-4-(2,3,5-trimethylpiperidin-1-yl)benzenesulfonamide |
| SMILES | CC1CC(C)C(C)N(c2ccc(S(N)(=O)=O)c(N)c2)C1 |
| InChI | InChI=1S/C14H23N3O2S/c1-9-6-10(2)11(3)17(8-9)12-4-5-14(13(15)7-12)20(16,18)19/h4-5,7,9-11H,6,8,15H2,1-3H3,(H2,16,18,19) |
| InChIKey | OCWSCLPDFIYSGR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|