C16H22N2O3 — CID 114593629
1-[2-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanone (PubChem CID 114593629) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[2-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanone.
| Compound Name | 1-[2-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 114593629 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-[2-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CC(C)CC(C)C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O3/c1-10-7-11(2)12(3)17(9-10)14-5-6-15(13(4)19)16(8-14)18(20)21/h5-6,8,10-12H,7,9H2,1-4H3 |
| InChIKey | YAAXHROQZXLMGA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|