C14H22N2O3S — CID 104939730
(1S)-1-[4-nitro-5-(2,3,5-trimethylpiperidin-1-yl)thiophen-2-yl]ethanol (PubChem CID 104939730) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is (1S)-1-[4-nitro-5-(2,3,5-trimethylpiperidin-1-yl)thiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[4-nitro-5-(2,3,5-trimethylpiperidin-1-yl)thiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 104939730 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (1S)-1-[4-nitro-5-(2,3,5-trimethylpiperidin-1-yl)thiophen-2-yl]ethanol |
| SMILES | CC1CC(C)C(C)N(c2sc([C@H](C)O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H22N2O3S/c1-8-5-9(2)10(3)15(7-8)14-12(16(18)19)6-13(20-14)11(4)17/h6,8-11,17H,5,7H2,1-4H3/t8?,9?,10?,11-/m0/s1 |
| InChIKey | DBZSNTGTRCQULB-QUBJWBRDSA-N |
| XLogP | 3.58 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|