C16H24N2O3 — CID 104939745
(1R)-1-[3-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol (PubChem CID 104939745) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R)-1-[3-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 104939745 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1R)-1-[3-nitro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol |
| SMILES | CC1CC(C)C(C)N(c2ccc([C@@H](C)O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H24N2O3/c1-10-7-11(2)12(3)17(9-10)15-6-5-14(13(4)19)8-16(15)18(20)21/h5-6,8,10-13,19H,7,9H2,1-4H3/t10?,11?,12?,13-/m1/s1 |
| InChIKey | RRFPQCDQSIXLCD-NODFVKRRSA-N |
| XLogP | 3.52 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|