C13H21N3O3S — CID 104937439
(1R)-1-[4-nitro-5-(3,4,5-trimethylpiperazin-1-yl)thiophen-2-yl]ethanol (PubChem CID 104937439) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (1R)-1-[4-nitro-5-(3,4,5-trimethylpiperazin-1-yl)thiophen-2-yl]ethanol.
| Compound Name | (1R)-1-[4-nitro-5-(3,4,5-trimethylpiperazin-1-yl)thiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 104937439 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1R)-1-[4-nitro-5-(3,4,5-trimethylpiperazin-1-yl)thiophen-2-yl]ethanol |
| SMILES | CC1CN(c2sc([C@@H](C)O)cc2[N+](=O)[O-])CC(C)N1C |
| InChI | InChI=1S/C13H21N3O3S/c1-8-6-15(7-9(2)14(8)4)13-11(16(18)19)5-12(20-13)10(3)17/h5,8-10,17H,6-7H2,1-4H3/t8?,9?,10-/m1/s1 |
| InChIKey | KZRZKYJNGQBXPB-UDNWOFFPSA-N |
| XLogP | 2.24 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|