C10H14N2O5S2 — CID 103941536
(1S)-1-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-nitrothiophen-2-yl]ethanol (PubChem CID 103941536) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1S)-1-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103941536 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (1S)-1-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@H](O)c1cc([N+](=O)[O-])c(N2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H14N2O5S2/c1-7(13)9-6-8(12(14)15)10(18-9)11-2-4-19(16,17)5-3-11/h6-7,13H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | AABADJDHOKQAIH-ZETCQYMHSA-N |
| XLogP | 0.94 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|