C13H20N2O3S — CID 103941989
(1S)-1-[5-(2,5-dimethylpiperidin-1-yl)-4-nitrothiophen-2-yl]ethanol (PubChem CID 103941989) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is (1S)-1-[5-(2,5-dimethylpiperidin-1-yl)-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[5-(2,5-dimethylpiperidin-1-yl)-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103941989 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (1S)-1-[5-(2,5-dimethylpiperidin-1-yl)-4-nitrothiophen-2-yl]ethanol |
| SMILES | CC1CCC(C)N(c2sc([C@H](C)O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H20N2O3S/c1-8-4-5-9(2)14(7-8)13-11(15(17)18)6-12(19-13)10(3)16/h6,8-10,16H,4-5,7H2,1-3H3/t8?,9?,10-/m0/s1 |
| InChIKey | IUMMEIWALVNXCE-RTBKNWGFSA-N |
| XLogP | 3.33 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|