C13H21N3O3S — CID 103941921
(1S)-1-[5-(4-ethyl-3-methylpiperazin-1-yl)-4-nitrothiophen-2-yl]ethanol (PubChem CID 103941921) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (1S)-1-[5-(4-ethyl-3-methylpiperazin-1-yl)-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[5-(4-ethyl-3-methylpiperazin-1-yl)-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103941921 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1S)-1-[5-(4-ethyl-3-methylpiperazin-1-yl)-4-nitrothiophen-2-yl]ethanol |
| SMILES | CCN1CCN(c2sc([C@H](C)O)cc2[N+](=O)[O-])CC1C |
| InChI | InChI=1S/C13H21N3O3S/c1-4-14-5-6-15(8-9(14)2)13-11(16(18)19)7-12(20-13)10(3)17/h7,9-10,17H,4-6,8H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | YBIZMEYZJPMUCM-AXDSSHIGSA-N |
| XLogP | 2.24 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|