C15H20N2O4 — CID 114593618
2-nitro-3-(2,3,5-trimethylpiperidin-1-yl)benzoic acid (PubChem CID 114593618) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-nitro-3-(2,3,5-trimethylpiperidin-1-yl)benzoic acid.
| Compound Name | 2-nitro-3-(2,3,5-trimethylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 114593618 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-nitro-3-(2,3,5-trimethylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CC(C)C(C)N(c2cccc(C(=O)O)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H20N2O4/c1-9-7-10(2)11(3)16(8-9)13-6-4-5-12(15(18)19)14(13)17(20)21/h4-6,9-11H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | IYQYPHJCPUXHIK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|