C14H18N2O4 — CID 115542114
3-(2,6-dimethylpiperidin-1-yl)-2-nitrobenzoic acid (PubChem CID 115542114) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidin-1-yl)-2-nitrobenzoic acid.
| Compound Name | 3-(2,6-dimethylpiperidin-1-yl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 115542114 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-(2,6-dimethylpiperidin-1-yl)-2-nitrobenzoic acid |
| SMILES | CC1CCCC(C)N1c1cccc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O4/c1-9-5-3-6-10(2)15(9)12-8-4-7-11(14(17)18)13(12)16(19)20/h4,7-10H,3,5-6H2,1-2H3,(H,17,18) |
| InChIKey | UOPWMSCJMADGAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|