C16H23NO2S — CID 114597259
2-methylsulfanyl-6-(2,3,5-trimethylpiperidin-1-yl)benzoic acid (PubChem CID 114597259) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(2,3,5-trimethylpiperidin-1-yl)benzoic acid.
| Compound Name | 2-methylsulfanyl-6-(2,3,5-trimethylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 114597259 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-methylsulfanyl-6-(2,3,5-trimethylpiperidin-1-yl)benzoic acid |
| SMILES | CSc1cccc(N2CC(C)CC(C)C2C)c1C(=O)O |
| InChI | InChI=1S/C16H23NO2S/c1-10-8-11(2)12(3)17(9-10)13-6-5-7-14(20-4)15(13)16(18)19/h5-7,10-12H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | RFZXKCWGBWDYKK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |