About N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine
N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine (PubChem CID 114594233) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine |
| PubChem CID | 114594233 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine |
| SMILES | CC1CC(C)C(C)N(c2ccccc2CNC(C)C)C1 |
| InChI | InChI=1S/C18H30N2/c1-13(2)19-11-17-8-6-7-9-18(17)20-12-14(3)10-15(4)16(20)5/h6-9,13-16,19H,10-12H2,1-5H3 |
| InChIKey | RHZIFWXBHDYETF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine?
The IUPAC name of N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine (CID 114594233) is N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine.
What is the SMILES notation for N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine?
The canonical SMILES for N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine is CC1CC(C)C(C)N(c2ccccc2CNC(C)C)C1.
What is the InChIKey of N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine?
The InChIKey is RHZIFWXBHDYETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2/c1-13(2)19-11-17-8-6-7-9-18(17)20-12-14(3)10-15(4)16(20)5/h6-9,13-16,19H,10-12H2,1-5H3.
What are the key properties of N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine?
N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine has a molecular weight of 274.45 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]propan-2-amine is sourced from PubChem (CID 114594233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).