C16H25NO — CID 104939735
(1S)-1-[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol (PubChem CID 104939735) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1S)-1-[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 104939735 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1S)-1-[2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanol |
| SMILES | CC1CC(C)C(C)N(c2ccccc2[C@H](C)O)C1 |
| InChI | InChI=1S/C16H25NO/c1-11-9-12(2)13(3)17(10-11)16-8-6-5-7-15(16)14(4)18/h5-8,11-14,18H,9-10H2,1-4H3/t11?,12?,13?,14-/m0/s1 |
| InChIKey | WQXIXHUHIHYMMH-XOZUOACSSA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |