C11H14N2O2 — CID 104613094
1-[2-amino-5-(1,2-oxazolidin-2-yl)phenyl]ethanone (PubChem CID 104613094) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-[2-amino-5-(1,2-oxazolidin-2-yl)phenyl]ethanone.
| Compound Name | 1-[2-amino-5-(1,2-oxazolidin-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 104613094 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-[2-amino-5-(1,2-oxazolidin-2-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(N2CCCO2)ccc1N |
| InChI | InChI=1S/C11H14N2O2/c1-8(14)10-7-9(3-4-11(10)12)13-5-2-6-15-13/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | DNMKIJXQNQPZDK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|