About ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine
ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine (PubChem CID 91221169) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine |
| PubChem CID | 91221169 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine |
| SMILES | CC.CC.CC1C=CC(N2CCN(C)CC2)=C1 |
| InChI | InChI=1S/C11H18N2.2C2H6/c1-10-3-4-11(9-10)13-7-5-12(2)6-8-13;2*1-2/h3-4,9-10H,5-8H2,1-2H3;2*1-2H3 |
| InChIKey | WUXKILVTRAWZCV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine?
The IUPAC name of ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine (CID 91221169) is ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine.
What is the SMILES notation for ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine?
The canonical SMILES for ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine is CC.CC.CC1C=CC(N2CCN(C)CC2)=C1.
What is the InChIKey of ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine?
The InChIKey is WUXKILVTRAWZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.2C2H6/c1-10-3-4-11(9-10)13-7-5-12(2)6-8-13;2*1-2/h3-4,9-10H,5-8H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine?
ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine has a molecular weight of 238.42 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-(3-methylcyclopenta-1,4-dien-1-yl)piperazine is sourced from PubChem (CID 91221169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).