C12H23N3 — CID 170605103
1-(2,3-dihydropyridin-5-yl)-4-methylpiperazine;ethane (PubChem CID 170605103) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-(2,3-dihydropyridin-5-yl)-4-methylpiperazine;ethane.
| Compound Name | 1-(2,3-dihydropyridin-5-yl)-4-methylpiperazine;ethane |
|---|---|
| PubChem CID | 170605103 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-(2,3-dihydropyridin-5-yl)-4-methylpiperazine;ethane |
| SMILES | CC.CN1CCN(C2=CCCN=C2)CC1 |
| InChI | InChI=1S/C10H17N3.C2H6/c1-12-5-7-13(8-6-12)10-3-2-4-11-9-10;1-2/h3,9H,2,4-8H2,1H3;1-2H3 |
| InChIKey | HZVFVSYFUUVJAU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |