C8H15N5 — CID 156839759
1-methyl-4-(1-methyl-1,2,4-triazol-3-yl)piperazine (PubChem CID 156839759) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-methyl-4-(1-methyl-1,2,4-triazol-3-yl)piperazine.
| Compound Name | 1-methyl-4-(1-methyl-1,2,4-triazol-3-yl)piperazine |
|---|---|
| PubChem CID | 156839759 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-methyl-4-(1-methyl-1,2,4-triazol-3-yl)piperazine |
| SMILES | CN1CCN(c2ncn(C)n2)CC1 |
| InChI | InChI=1S/C8H15N5/c1-11-3-5-13(6-4-11)8-9-7-12(2)10-8/h7H,3-6H2,1-2H3 |
| InChIKey | USZDSJRITCVGGK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |