C10H18N4 — CID 174436389
1-(1,3-dimethylpyrazol-4-yl)-4-methylpiperazine (PubChem CID 174436389) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-4-methylpiperazine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 174436389 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-4-methylpiperazine |
| SMILES | Cc1nn(C)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C10H18N4/c1-9-10(8-13(3)11-9)14-6-4-12(2)5-7-14/h8H,4-7H2,1-3H3 |
| InChIKey | NEIXVEGBDOFZDY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |