C15H27ClN2 — CID 143065016
1-(5-chlorocyclohepta-1,6-dien-1-yl)-4-methyl-1,4-diazepane;ethane (PubChem CID 143065016) has the molecular formula C15H27ClN2 and a molecular weight of 270.85 g/mol. Its IUPAC name is 1-(5-chlorocyclohepta-1,6-dien-1-yl)-4-methyl-1,4-diazepane;ethane.
| Compound Name | 1-(5-chlorocyclohepta-1,6-dien-1-yl)-4-methyl-1,4-diazepane;ethane |
|---|---|
| PubChem CID | 143065016 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(5-chlorocyclohepta-1,6-dien-1-yl)-4-methyl-1,4-diazepane;ethane |
| SMILES | CC.CN1CCCN(C2=CCCC(Cl)C=C2)CC1 |
| InChI | InChI=1S/C13H21ClN2.C2H6/c1-15-8-3-9-16(11-10-15)13-5-2-4-12(14)6-7-13;1-2/h5-7,12H,2-4,8-11H2,1H3;1-2H3 |
| InChIKey | GEEYBSUAOPZWHV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|