About 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine
1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 67558212) has the molecular formula C11H16IN
and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 67558212 |
| Molecular Formula | C11H16IN |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | IC1C=CC(N2CCCCC2)=CC1 |
| InChI | InChI=1S/C11H16IN/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13/h4,6-7,10H,1-3,5,8-9H2 |
| InChIKey | CGBQGVSXELYFBI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine (CID 67558212) is 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine is IC1C=CC(N2CCCCC2)=CC1.
What is the InChIKey of 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is CGBQGVSXELYFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16IN/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13/h4,6-7,10H,1-3,5,8-9H2.
What are the key properties of 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine?
1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 289.16 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 67558212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).