C11H16IN — CID 67558212
1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 67558212) has the molecular formula C11H16IN and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine.
| Compound Name | 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 67558212 |
| Molecular Formula | C11H16IN |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-(4-iodocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | IC1C=CC(N2CCCCC2)=CC1 |
| InChI | InChI=1S/C11H16IN/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13/h4,6-7,10H,1-3,5,8-9H2 |
| InChIKey | CGBQGVSXELYFBI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|