C11H15NO3 — CID 134570528
4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 134570528) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 134570528 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC(N2CCOCC2)=CC1 |
| InChI | InChI=1S/C11H15NO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1,3-4,9H,2,5-8H2,(H,13,14) |
| InChIKey | LLPZPRKUANFBLN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |