4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid

C11H15NO3 — CID 134570528

IUPAC4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC(N2CCOCC2)=CC1
InChIInChI=1S/C11H15NO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1,3-4,9H,2,5-8H2,(H,13,14)
InChIKeyLLPZPRKUANFBLN-UHFFFAOYSA-N
MW209.24 g/mol
LogP0.86
Rot. Bonds2

About 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid

4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 134570528) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid
PubChem CID134570528
Molecular FormulaC11H15NO3
Molecular Weight209.24 g/mol
Exact Mass209.11
IUPAC Name4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC(N2CCOCC2)=CC1
InChIInChI=1S/C11H15NO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1,3-4,9H,2,5-8H2,(H,13,14)
InChIKeyLLPZPRKUANFBLN-UHFFFAOYSA-N
XLogP0.86
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.24
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid (CID 134570528) is 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC(N2CCOCC2)=CC1.
What is the InChIKey of 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is LLPZPRKUANFBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1,3-4,9H,2,5-8H2,(H,13,14).
What are the key properties of 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid?
4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 209.24 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-ylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 134570528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).