C13H18N2O4 — CID 162262966
spiro[4,6,7,9-tetrahydropyrimido[1,2-d][1,4]oxazepine-10,4'-oxane]-2-carboxylic acid (PubChem CID 162262966) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is spiro[4,6,7,9-tetrahydropyrimido[1,2-d][1,4]oxazepine-10,4'-oxane]-2-carboxylic acid.
| Compound Name | spiro[4,6,7,9-tetrahydropyrimido[1,2-d][1,4]oxazepine-10,4'-oxane]-2-carboxylic acid |
|---|---|
| PubChem CID | 162262966 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | spiro[4,6,7,9-tetrahydropyrimido[1,2-d][1,4]oxazepine-10,4'-oxane]-2-carboxylic acid |
| SMILES | O=C(O)C1=CCN2CCOCC3(CCOCC3)C2=N1 |
| InChI | InChI=1S/C13H18N2O4/c16-11(17)10-1-4-15-5-8-19-9-13(12(15)14-10)2-6-18-7-3-13/h1H,2-9H2,(H,16,17) |
| InChIKey | ZZMSUBVJQSWVLU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |