C20H22N2O6 — CID 23793828
4,5-dimorpholin-4-ylnaphthalene-1,8-dicarboxylic acid (PubChem CID 23793828) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 4,5-dimorpholin-4-ylnaphthalene-1,8-dicarboxylic acid.
| Compound Name | 4,5-dimorpholin-4-ylnaphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 23793828 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4,5-dimorpholin-4-ylnaphthalene-1,8-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCOCC2)c2c(N3CCOCC3)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C20H22N2O6/c23-19(24)13-1-3-15(21-5-9-27-10-6-21)18-16(22-7-11-28-12-8-22)4-2-14(17(13)18)20(25)26/h1-4H,5-12H2,(H,23,24)(H,25,26) |
| InChIKey | XFYYINSXOKVXAY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |