C10H13Cl2N3OZn — CID 159643901
zinc;4-(4-diazocyclohexa-1,5-dien-1-yl)morpholine;dichloride (PubChem CID 159643901) has the molecular formula C10H13Cl2N3OZn and a molecular weight of 327.53 g/mol. Its IUPAC name is zinc;4-(4-diazocyclohexa-1,5-dien-1-yl)morpholine;dichloride.
| Compound Name | zinc;4-(4-diazocyclohexa-1,5-dien-1-yl)morpholine;dichloride |
|---|---|
| PubChem CID | 159643901 |
| Molecular Formula | C10H13Cl2N3OZn |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | zinc;4-(4-diazocyclohexa-1,5-dien-1-yl)morpholine;dichloride |
| SMILES | [Cl-].[Cl-].[N-]=[N+]=C1C=CC(N2CCOCC2)=CC1.[Zn+2] |
| InChI | InChI=1S/C10H13N3O.2ClH.Zn/c11-12-9-1-3-10(4-2-9)13-5-7-14-8-6-13;;;/h1,3-4H,2,5-8H2;2*1H;/q;;;+2/p-2 |
| InChIKey | MQSAHXFIRFKOQA-UHFFFAOYSA-L |
| XLogP | -5.16 |
| TPSA | 48.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|