C15H18N2O — CID 22758263
4-(5-pyridin-4-ylcyclohexa-1,5-dien-1-yl)morpholine (PubChem CID 22758263) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(5-pyridin-4-ylcyclohexa-1,5-dien-1-yl)morpholine.
| Compound Name | 4-(5-pyridin-4-ylcyclohexa-1,5-dien-1-yl)morpholine |
|---|---|
| PubChem CID | 22758263 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-(5-pyridin-4-ylcyclohexa-1,5-dien-1-yl)morpholine |
| SMILES | C1=C(c2ccncc2)CCC=C1N1CCOCC1 |
| InChI | InChI=1S/C15H18N2O/c1-2-14(13-4-6-16-7-5-13)12-15(3-1)17-8-10-18-11-9-17/h3-7,12H,1-2,8-11H2 |
| InChIKey | FBKFDGPLLAIGOO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |