C10H16N2O — CID 142249053
4-(6-methyl-3,4-dihydropyridin-2-yl)morpholine (PubChem CID 142249053) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(6-methyl-3,4-dihydropyridin-2-yl)morpholine.
| Compound Name | 4-(6-methyl-3,4-dihydropyridin-2-yl)morpholine |
|---|---|
| PubChem CID | 142249053 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-(6-methyl-3,4-dihydropyridin-2-yl)morpholine |
| SMILES | CC1=CCCC(N2CCOCC2)=N1 |
| InChI | InChI=1S/C10H16N2O/c1-9-3-2-4-10(11-9)12-5-7-13-8-6-12/h3H,2,4-8H2,1H3 |
| InChIKey | TTXUGNGYUZTBKO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |