C13H23NO — CID 143791147
ethane;4-(2-methylcyclohexa-1,5-dien-1-yl)morpholine (PubChem CID 143791147) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;4-(2-methylcyclohexa-1,5-dien-1-yl)morpholine.
| Compound Name | ethane;4-(2-methylcyclohexa-1,5-dien-1-yl)morpholine |
|---|---|
| PubChem CID | 143791147 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;4-(2-methylcyclohexa-1,5-dien-1-yl)morpholine |
| SMILES | CC.CC1=C(N2CCOCC2)C=CCC1 |
| InChI | InChI=1S/C11H17NO.C2H6/c1-10-4-2-3-5-11(10)12-6-8-13-9-7-12;1-2/h3,5H,2,4,6-9H2,1H3;1-2H3 |
| InChIKey | NDVQZNFLENCBIW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |