About ethane;4-pyrazin-2-ylmorpholine
ethane;4-pyrazin-2-ylmorpholine (PubChem CID 143018931) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is ethane;4-pyrazin-2-ylmorpholine.
Molecular Properties
| Compound Name | ethane;4-pyrazin-2-ylmorpholine |
| PubChem CID | 143018931 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | ethane;4-pyrazin-2-ylmorpholine |
| SMILES | CC.c1cnc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C8H11N3O.C2H6/c1-2-10-8(7-9-1)11-3-5-12-6-4-11;1-2/h1-2,7H,3-6H2;1-2H3 |
| InChIKey | WXLQEIOXAQVIBH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-pyrazin-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-pyrazin-2-ylmorpholine?
The IUPAC name of ethane;4-pyrazin-2-ylmorpholine (CID 143018931) is ethane;4-pyrazin-2-ylmorpholine.
What is the SMILES notation for ethane;4-pyrazin-2-ylmorpholine?
The canonical SMILES for ethane;4-pyrazin-2-ylmorpholine is CC.c1cnc(N2CCOCC2)cn1.
What is the InChIKey of ethane;4-pyrazin-2-ylmorpholine?
The InChIKey is WXLQEIOXAQVIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O.C2H6/c1-2-10-8(7-9-1)11-3-5-12-6-4-11;1-2/h1-2,7H,3-6H2;1-2H3.
What are the key properties of ethane;4-pyrazin-2-ylmorpholine?
ethane;4-pyrazin-2-ylmorpholine has a molecular weight of 195.27 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-pyrazin-2-ylmorpholine is sourced from PubChem (CID 143018931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).