About ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine
ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine (PubChem CID 145131750) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine.
Molecular Properties
| Compound Name | ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine |
| PubChem CID | 145131750 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine |
| SMILES | CC.Cc1ncoc1N1CCOCC1 |
| InChI | InChI=1S/C8H12N2O2.C2H6/c1-7-8(12-6-9-7)10-2-4-11-5-3-10;1-2/h6H,2-5H2,1H3;1-2H3 |
| InChIKey | QDOTVUXSYMTPSN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine?
The IUPAC name of ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine (CID 145131750) is ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine.
What is the SMILES notation for ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine?
The canonical SMILES for ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine is CC.Cc1ncoc1N1CCOCC1.
What is the InChIKey of ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine?
The InChIKey is QDOTVUXSYMTPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.C2H6/c1-7-8(12-6-9-7)10-2-4-11-5-3-10;1-2/h6H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine?
ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine has a molecular weight of 198.27 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methyl-1,3-oxazol-5-yl)morpholine is sourced from PubChem (CID 145131750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).