C13H22N2O — CID 177212902
4-(2,5-dimethyl-4-pyridinyl)morpholine;ethane (PubChem CID 177212902) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-(2,5-dimethyl-4-pyridinyl)morpholine;ethane.
| Compound Name | 4-(2,5-dimethyl-4-pyridinyl)morpholine;ethane |
|---|---|
| PubChem CID | 177212902 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-(2,5-dimethyl-4-pyridinyl)morpholine;ethane |
| SMILES | CC.Cc1cc(N2CCOCC2)c(C)cn1 |
| InChI | InChI=1S/C11H16N2O.C2H6/c1-9-8-12-10(2)7-11(9)13-3-5-14-6-4-13;1-2/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | DJIONHHBECJZOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |