C12H18N2O — CID 172568291
4-(2,3,6-trimethyl-4-pyridinyl)morpholine (PubChem CID 172568291) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(2,3,6-trimethyl-4-pyridinyl)morpholine.
| Compound Name | 4-(2,3,6-trimethyl-4-pyridinyl)morpholine |
|---|---|
| PubChem CID | 172568291 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-(2,3,6-trimethyl-4-pyridinyl)morpholine |
| SMILES | Cc1cc(N2CCOCC2)c(C)c(C)n1 |
| InChI | InChI=1S/C12H18N2O/c1-9-8-12(10(2)11(3)13-9)14-4-6-15-7-5-14/h8H,4-7H2,1-3H3 |
| InChIKey | VSQRAEUNTMBEQE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |