C12H19N3O — CID 81248036
[6-methyl-4-(1,4-oxazepan-4-yl)-3-pyridinyl]methanamine (PubChem CID 81248036) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is [6-methyl-4-(1,4-oxazepan-4-yl)-3-pyridinyl]methanamine.
| Compound Name | [6-methyl-4-(1,4-oxazepan-4-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81248036 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [6-methyl-4-(1,4-oxazepan-4-yl)-3-pyridinyl]methanamine |
| SMILES | Cc1cc(N2CCCOCC2)c(CN)cn1 |
| InChI | InChI=1S/C12H19N3O/c1-10-7-12(11(8-13)9-14-10)15-3-2-5-16-6-4-15/h7,9H,2-6,8,13H2,1H3 |
| InChIKey | OSPSTTCIPDLUDN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |