About azane;4-(6-methyl-2-pyridinyl)morpholine
azane;4-(6-methyl-2-pyridinyl)morpholine (PubChem CID 175085700) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is azane;4-(6-methyl-2-pyridinyl)morpholine.
Molecular Properties
| Compound Name | azane;4-(6-methyl-2-pyridinyl)morpholine |
| PubChem CID | 175085700 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | azane;4-(6-methyl-2-pyridinyl)morpholine |
| SMILES | Cc1cccc(N2CCOCC2)n1.N |
| InChI | InChI=1S/C10H14N2O.H3N/c1-9-3-2-4-10(11-9)12-5-7-13-8-6-12;/h2-4H,5-8H2,1H3;1H3 |
| InChIKey | GYGIJJNDGWBNIE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;4-(6-methyl-2-pyridinyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(6-methyl-2-pyridinyl)morpholine?
The IUPAC name of azane;4-(6-methyl-2-pyridinyl)morpholine (CID 175085700) is azane;4-(6-methyl-2-pyridinyl)morpholine.
What is the SMILES notation for azane;4-(6-methyl-2-pyridinyl)morpholine?
The canonical SMILES for azane;4-(6-methyl-2-pyridinyl)morpholine is Cc1cccc(N2CCOCC2)n1.N.
What is the InChIKey of azane;4-(6-methyl-2-pyridinyl)morpholine?
The InChIKey is GYGIJJNDGWBNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.H3N/c1-9-3-2-4-10(11-9)12-5-7-13-8-6-12;/h2-4H,5-8H2,1H3;1H3.
What are the key properties of azane;4-(6-methyl-2-pyridinyl)morpholine?
azane;4-(6-methyl-2-pyridinyl)morpholine has a molecular weight of 195.27 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(6-methyl-2-pyridinyl)morpholine is sourced from PubChem (CID 175085700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).