About ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine
ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine (PubChem CID 156652479) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine.
Molecular Properties
| Compound Name | ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine |
| PubChem CID | 156652479 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine |
| SMILES | CC.CNC.Cc1cccc(N2CCCC2)n1 |
| InChI | InChI=1S/C10H14N2.C2H7N.C2H6/c1-9-5-4-6-10(11-9)12-7-2-3-8-12;1-3-2;1-2/h4-6H,2-3,7-8H2,1H3;3H,1-2H3;1-2H3 |
| InChIKey | XDUXMYCNBQTWQL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine?
The IUPAC name of ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine (CID 156652479) is ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine.
What is the SMILES notation for ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine?
The canonical SMILES for ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine is CC.CNC.Cc1cccc(N2CCCC2)n1.
What is the InChIKey of ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine?
The InChIKey is XDUXMYCNBQTWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H7N.C2H6/c1-9-5-4-6-10(11-9)12-7-2-3-8-12;1-3-2;1-2/h4-6H,2-3,7-8H2,1H3;3H,1-2H3;1-2H3.
What are the key properties of ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine?
ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine has a molecular weight of 237.39 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanamine;2-methyl-6-pyrrolidin-1-ylpyridine is sourced from PubChem (CID 156652479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).