C14H21N3O2S — CID 163346171
1-cyclopropylsulfonyl-4-(6-methyl-2-pyridinyl)-1,4-diazepane (PubChem CID 163346171) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-4-(6-methyl-2-pyridinyl)-1,4-diazepane.
| Compound Name | 1-cyclopropylsulfonyl-4-(6-methyl-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 163346171 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-cyclopropylsulfonyl-4-(6-methyl-2-pyridinyl)-1,4-diazepane |
| SMILES | Cc1cccc(N2CCCN(S(=O)(=O)C3CC3)CC2)n1 |
| InChI | InChI=1S/C14H21N3O2S/c1-12-4-2-5-14(15-12)16-8-3-9-17(11-10-16)20(18,19)13-6-7-13/h2,4-5,13H,3,6-11H2,1H3 |
| InChIKey | PIZLDSNXTGJQRQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |