C16H26N4O2S — CID 138020046
2,4-dimethyl-6-(4-piperidin-1-ylsulfonylpiperidin-1-yl)pyrimidine (PubChem CID 138020046) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4-piperidin-1-ylsulfonylpiperidin-1-yl)pyrimidine.
| Compound Name | 2,4-dimethyl-6-(4-piperidin-1-ylsulfonylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 138020046 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2,4-dimethyl-6-(4-piperidin-1-ylsulfonylpiperidin-1-yl)pyrimidine |
| SMILES | Cc1cc(N2CCC(S(=O)(=O)N3CCCCC3)CC2)nc(C)n1 |
| InChI | InChI=1S/C16H26N4O2S/c1-13-12-16(18-14(2)17-13)19-10-6-15(7-11-19)23(21,22)20-8-4-3-5-9-20/h12,15H,3-11H2,1-2H3 |
| InChIKey | ZKQASFHQLYTRAO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |