C13H19N3O — CID 63846335
1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl]ethanone (PubChem CID 63846335) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl]ethanone.
| Compound Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 63846335 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl]ethanone |
| SMILES | CC(=O)C1CCCN(c2cc(C)nc(C)n2)C1 |
| InChI | InChI=1S/C13H19N3O/c1-9-7-13(15-11(3)14-9)16-6-4-5-12(8-16)10(2)17/h7,12H,4-6,8H2,1-3H3 |
| InChIKey | CHOBSNONLPHJKP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |