C20H34N4O2S — CID 133383773
2,4-ditert-butyl-6-(3-pyrrolidin-1-ylsulfonylpyrrolidin-1-yl)pyrimidine (PubChem CID 133383773) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(3-pyrrolidin-1-ylsulfonylpyrrolidin-1-yl)pyrimidine.
| Compound Name | 2,4-ditert-butyl-6-(3-pyrrolidin-1-ylsulfonylpyrrolidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 133383773 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(3-pyrrolidin-1-ylsulfonylpyrrolidin-1-yl)pyrimidine |
| SMILES | CC(C)(C)c1cc(N2CCC(S(=O)(=O)N3CCCC3)C2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C20H34N4O2S/c1-19(2,3)16-13-17(22-18(21-16)20(4,5)6)23-12-9-15(14-23)27(25,26)24-10-7-8-11-24/h13,15H,7-12,14H2,1-6H3 |
| InChIKey | ABLJBUPZUJFBKZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |