C19H33N3O — CID 133397917
1-[1-(2,6-ditert-butylpyrimidin-4-yl)piperidin-3-yl]ethanol (PubChem CID 133397917) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-[1-(2,6-ditert-butylpyrimidin-4-yl)piperidin-3-yl]ethanol.
| Compound Name | 1-[1-(2,6-ditert-butylpyrimidin-4-yl)piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 133397917 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-[1-(2,6-ditert-butylpyrimidin-4-yl)piperidin-3-yl]ethanol |
| SMILES | CC(O)C1CCCN(c2cc(C(C)(C)C)nc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C19H33N3O/c1-13(23)14-9-8-10-22(12-14)16-11-15(18(2,3)4)20-17(21-16)19(5,6)7/h11,13-14,23H,8-10,12H2,1-7H3 |
| InChIKey | JBELDQRZZPJHBQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |