C8H10Br2N2O — CID 159363867
4-(4,5-dibromo-3H-pyrrol-2-yl)morpholine (PubChem CID 159363867) has the molecular formula C8H10Br2N2O and a molecular weight of 309.99 g/mol. Its IUPAC name is 4-(4,5-dibromo-3H-pyrrol-2-yl)morpholine.
| Compound Name | 4-(4,5-dibromo-3H-pyrrol-2-yl)morpholine |
|---|---|
| PubChem CID | 159363867 |
| Molecular Formula | C8H10Br2N2O |
| Molecular Weight | 309.99 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | 4-(4,5-dibromo-3H-pyrrol-2-yl)morpholine |
| SMILES | BrC1=C(Br)N=C(N2CCOCC2)C1 |
| InChI | InChI=1S/C8H10Br2N2O/c9-6-5-7(11-8(6)10)12-1-3-13-4-2-12/h1-5H2 |
| InChIKey | SCQPVRPCFAGELD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.99 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|