C11H17N5O2S — CID 977254
2,6-dimorpholin-4-yl-1H-1,3,5-triazine-4-thione (PubChem CID 977254) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is 2,6-dimorpholin-4-yl-1H-1,3,5-triazine-4-thione.
| Compound Name | 2,6-dimorpholin-4-yl-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 977254 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2,6-dimorpholin-4-yl-1H-1,3,5-triazine-4-thione |
| SMILES | S=c1nc(N2CCOCC2)[nH]c(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H17N5O2S/c19-11-13-9(15-1-5-17-6-2-15)12-10(14-11)16-3-7-18-8-4-16/h1-8H2,(H,12,13,14,19) |
| InChIKey | UABCJKPCNYMEPU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|