C10H13N5O3 — CID 840608
3-methyl-8-morpholin-4-yl-7H-purine-2,6-dione (PubChem CID 840608) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 3-methyl-8-morpholin-4-yl-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-morpholin-4-yl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 840608 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-methyl-8-morpholin-4-yl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(N3CCOCC3)nc21 |
| InChI | InChI=1S/C10H13N5O3/c1-14-7-6(8(16)13-10(14)17)11-9(12-7)15-2-4-18-5-3-15/h2-5H2,1H3,(H,11,12)(H,13,16,17) |
| InChIKey | WISDVJJIZSKFEJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |