C14H21N5O3 — CID 167947110
8-(4-methoxy-3,3-dimethylpiperidin-1-yl)-3-methyl-7H-purine-2,6-dione (PubChem CID 167947110) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 8-(4-methoxy-3,3-dimethylpiperidin-1-yl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(4-methoxy-3,3-dimethylpiperidin-1-yl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 167947110 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 8-(4-methoxy-3,3-dimethylpiperidin-1-yl)-3-methyl-7H-purine-2,6-dione |
| SMILES | COC1CCN(c2nc3c([nH]2)c(=O)[nH]c(=O)n3C)CC1(C)C |
| InChI | InChI=1S/C14H21N5O3/c1-14(2)7-19(6-5-8(14)22-4)12-15-9-10(16-12)18(3)13(21)17-11(9)20/h8H,5-7H2,1-4H3,(H,15,16)(H,17,20,21) |
| InChIKey | RRTAYWXZMNQXNP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |