C11H17N6O2+ — CID 7047717
1,3-dimethyl-8-piperazin-4-ium-1-yl-7H-purine-2,6-dione (PubChem CID 7047717) has the molecular formula C11H17N6O2+ and a molecular weight of 265.30 g/mol. Its IUPAC name is 1,3-dimethyl-8-piperazin-4-ium-1-yl-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-piperazin-4-ium-1-yl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 7047717 |
| Molecular Formula | C11H17N6O2+ |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1,3-dimethyl-8-piperazin-4-ium-1-yl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(N3CC[NH2+]CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C11H16N6O2/c1-15-8-7(9(18)16(2)11(15)19)13-10(14-8)17-5-3-12-4-6-17/h12H,3-6H2,1-2H3,(H,13,14)/p+1 |
| InChIKey | MRKDHWMFYIEUEY-UHFFFAOYSA-O |
| XLogP | -2.66 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |