C21H23N7O4 — CID 1496655
8-[4-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]piperazin-1-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 1496655) has the molecular formula C21H23N7O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 8-[4-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]piperazin-1-yl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[4-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]piperazin-1-yl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 1496655 |
| Molecular Formula | C21H23N7O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 8-[4-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]piperazin-1-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(N3CCN([C@@H]4CC(=O)N(c5ccccc5)C4=O)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C21H23N7O4/c1-24-17-16(19(31)25(2)21(24)32)22-20(23-17)27-10-8-26(9-11-27)14-12-15(29)28(18(14)30)13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | QFSMHBBMPAYOTH-CQSZACIVSA-N |
| XLogP | -0.59 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|