C10H14N4O3 — CID 112569040
8-(1-hydroxy-2-methylpropan-2-yl)-3-methyl-7H-purine-2,6-dione (PubChem CID 112569040) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 8-(1-hydroxy-2-methylpropan-2-yl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-hydroxy-2-methylpropan-2-yl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 112569040 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 8-(1-hydroxy-2-methylpropan-2-yl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(C(C)(C)CO)nc21 |
| InChI | InChI=1S/C10H14N4O3/c1-10(2,4-15)8-11-5-6(12-8)14(3)9(17)13-7(5)16/h15H,4H2,1-3H3,(H,11,12)(H,13,16,17) |
| InChIKey | GXWJMQTWYPTTBM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |