C8H9N5O4 — CID 129250242
methyl-(3-methyl-2,6-dioxo-7H-purin-8-yl)carbamic acid (PubChem CID 129250242) has the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. Its IUPAC name is methyl-(3-methyl-2,6-dioxo-7H-purin-8-yl)carbamic acid.
| Compound Name | methyl-(3-methyl-2,6-dioxo-7H-purin-8-yl)carbamic acid |
|---|---|
| PubChem CID | 129250242 |
| Molecular Formula | C8H9N5O4 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl-(3-methyl-2,6-dioxo-7H-purin-8-yl)carbamic acid |
| SMILES | CN(C(=O)O)c1nc2c([nH]1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C8H9N5O4/c1-12-4-3(5(14)11-7(12)15)9-6(10-4)13(2)8(16)17/h1-2H3,(H,9,10)(H,16,17)(H,11,14,15) |
| InChIKey | RMSRLSOJHKKVPR-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |